What is the mass of diphosphorus pentoxide used?
What is the mass of diphosphorus pentoxide used?
283.9 g mol
Phosphorus pentoxide
| Names | |
|---|---|
| Chemical formula | P4O10 |
| Molar mass | 283.9 g mol−1 |
| Appearance | white powder very deliquescent odorless |
| Density | 2.39 g/cm3 |
What is the mass of one molecule of diphosphorus pentoxide?
Identification of Diphosphorus pentoxide Chemical Compound
| Chemical Formula | O10P4 |
|---|---|
| Molecular Weight | 283.889048 g/mol |
| IUPAC Name | tricyclo[3.3.1.1^{3,7}]tetraphosphoxane-1,3,5,7-tetrone |
| SMILES String | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| InChI | InChI=1S/O10P4/c1-11-5-12(2)8-13(3,6-11)10-14(4,7-11)9-12 |
What is the formula for diphosphorus pentoxide *?
P₄O₁₀
Phosphorus pentoxide/Formula
How do you find the molar mass of diphosphorus pentoxide?
Thus, the molar mass of diphosphorus pentoxide is M(P4O10) = 30.973762(4) + 15.999(10) = 283.886 g/mol.
What is the formula for diphosphorus trioxide?
Phosphorus trioxide
| PubChem CID | 14810 |
|---|---|
| Molecular Formula | O3P2 |
| Synonyms | Phosphorus trioxide Diphosphorus trioxide 1314-24-5 UNII-0LTR52K7HK PHOSPHORUS OXIDE (P2O3) More… |
| Molecular Weight | 109.946 |
| Dates | Modify 2022-01-15 Create 2005-03-27 |
What is the density of diphosphorus pentoxide?
2.39 g/cm³
Phosphorus pentoxide/Density
Preparation: The main preparation method for phosphorous pentoxide is the reaction of tetraphosphorus with oxygen gas. It is burned producing the P4O10. Physical properties: Phosphorus pentoxide is a white deliquescent solid. Its density is 2.39 g/mL.
What is the formula for Diphosphorus Trisulfide?
P2S3
Phosphorus sulfide (P2S3)
| PubChem CID | 16211604 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | P2S3 |
| Synonyms | Phosphorus sulfide (P2S3) Phosphorus trisulfide 12165-69-4 Diphosphorus trisulphide 81129-00-2 More… |
| Molecular Weight | 158.2 |
What is the formula for Diphosphorus tetrafluoride?
P2F4
Diphosphorus tetrafluoride/Formula
What is the formula of ammonium?
NH₄⁺
Ammonium/Formula
What is the formula for dinitrogen pentoxide?
N2O5
Dinitrogen pentoxide/Formula
What is P2O5’s chemical name?
Physical Properties Phosphorus pentoxide is a white solid which does not have any distinct odour. The chemical formula of this compound is P 4 O 10. However, it is named after its empirical formula, which is P 2 O 5. The molar mass of phosphorus pentoxide corresponds to 283.9 g/mol. The density of this solid is 2.39 g/cm 3. The melting point of this P 2 O 5 is 613K.
What is the formula for diphosphorous pentabromide?
Diphosphorus Pentoxide is a covalent compound that has an empirical formula of P 2 O 5 and a chemical formula of P4O10 . The molar mass of diphosphorus pentoxide is the sum total of the molar mass of each of the atoms in its chemical formula.
What is the formula for diphosphorus hepta chloride?
What Is The Formula For Diphosphorus Heptachloride P_2Cl_7 P_2Cl_5 P_3Cl_7 P_2Cl-4 P_4Cl_7. May Be harmful if swallowed. Epoxy Heptachloride Epoxy or polyepoxide is a thermosetting polymer formed from reaction of an epoxide “resin” with polyamine “hardener”.
What is phosphorus pentoxide used for?
Most practical applications and uses of phosphorus pentoxide are centered around its extreme affinity to water, which makes it an excellent dehydrating agent. ► It is used as a dehydrating agent in organic synthesis, which is the process of forming organic compounds through reactions of other organic compounds.